C25H19BCl2N2O4 — CID 139056317
dichloromethane;1,10-phenanthrolin-10-ium;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene] (PubChem CID 139056317) has the molecular formula C25H19BCl2N2O4 and a molecular weight of 493.16 g/mol. Its IUPAC name is dichloromethane;1,10-phenanthrolin-10-ium;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene].
| Compound Name | dichloromethane;1,10-phenanthrolin-10-ium;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene] |
|---|---|
| PubChem CID | 139056317 |
| Molecular Formula | C25H19BCl2N2O4 |
| Molecular Weight | 493.16 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | dichloromethane;1,10-phenanthrolin-10-ium;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene] |
| SMILES | ClCCl.c1ccc2c(c1)O[B-]1(O2)Oc2ccccc2O1.c1cnc2c(c1)ccc1ccc[nH+]c12 |
| InChI | InChI=1S/C12H8BO4.C12H8N2.CH2Cl2/c1-2-6-10-9(5-1)14-13(15-10)16-11-7-3-4-8-12(11)17-13;1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;2-1-3/h1-8H;1-8H;1H2/q-1;;/p+1 |
| InChIKey | UIKMMGQEIHDCOF-UHFFFAOYSA-O |
| XLogP | 5.99 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.16 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|