C28H28N2O2 — CID 139056542
2-[[[(1S,2R)-2-[(2-hydroxyphenyl)methylamino]-1,2-diphenylethyl]amino]methyl]phenol (PubChem CID 139056542) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is 2-[[[(1S,2R)-2-[(2-hydroxyphenyl)methylamino]-1,2-diphenylethyl]amino]methyl]phenol.
| Compound Name | 2-[[[(1S,2R)-2-[(2-hydroxyphenyl)methylamino]-1,2-diphenylethyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 139056542 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 2-[[[(1S,2R)-2-[(2-hydroxyphenyl)methylamino]-1,2-diphenylethyl]amino]methyl]phenol |
| SMILES | Oc1ccccc1CN[C@H](c1ccccc1)[C@@H](NCc1ccccc1O)c1ccccc1 |
| InChI | InChI=1S/C28H28N2O2/c31-25-17-9-7-15-23(25)19-29-27(21-11-3-1-4-12-21)28(22-13-5-2-6-14-22)30-20-24-16-8-10-18-26(24)32/h1-18,27-32H,19-20H2/t27-,28+ |
| InChIKey | XFHNUHMEFRANKU-HNRBIFIRSA-N |
| XLogP | 5.46 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|