C15H22O4 — CID 139056808
(3'aR,3'bS,6'aR,7'aS)-5,5-dimethylspiro[1,3-dioxane-2,5'-3,3a,3b,4,6,6a,7,7a-octahydropentaleno[2,1-b]furan]-2'-one (PubChem CID 139056808) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (3'aR,3'bS,6'aR,7'aS)-5,5-dimethylspiro[1,3-dioxane-2,5'-3,3a,3b,4,6,6a,7,7a-octahydropentaleno[2,1-b]furan]-2'-one.
| Compound Name | (3'aR,3'bS,6'aR,7'aS)-5,5-dimethylspiro[1,3-dioxane-2,5'-3,3a,3b,4,6,6a,7,7a-octahydropentaleno[2,1-b]furan]-2'-one |
|---|---|
| PubChem CID | 139056808 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (3'aR,3'bS,6'aR,7'aS)-5,5-dimethylspiro[1,3-dioxane-2,5'-3,3a,3b,4,6,6a,7,7a-octahydropentaleno[2,1-b]furan]-2'-one |
| SMILES | CC1(C)COC2(C[C@H]3C[C@@H]4OC(=O)C[C@@H]4[C@H]3C2)OC1 |
| InChI | InChI=1S/C15H22O4/c1-14(2)7-17-15(18-8-14)5-9-3-12-10(11(9)6-15)4-13(16)19-12/h9-12H,3-8H2,1-2H3/t9-,10-,11+,12+/m1/s1 |
| InChIKey | YVOMTIWBJKYCFV-WYUUTHIRSA-N |
| XLogP | 2.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |