C26H29F6NO3 — CID 139056863
tert-butyl (2S,3S,4S,5S)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dimethyl-5-phenylpyrrolidine-1-carboxylate (PubChem CID 139056863) has the molecular formula C26H29F6NO3 and a molecular weight of 517.51 g/mol. Its IUPAC name is tert-butyl (2S,3S,4S,5S)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dimethyl-5-phenylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S,4S,5S)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dimethyl-5-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139056863 |
| Molecular Formula | C26H29F6NO3 |
| Molecular Weight | 517.51 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | tert-butyl (2S,3S,4S,5S)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dimethyl-5-phenylpyrrolidine-1-carboxylate |
| SMILES | C[C@@H]1[C@H](OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@H](c2ccccc2)N(C(=O)OC(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C26H29F6NO3/c1-15-16(2)33(23(34)36-24(3,4)5)21(18-9-7-6-8-10-18)22(15)35-14-17-11-19(25(27,28)29)13-20(12-17)26(30,31)32/h6-13,15-16,21-22H,14H2,1-5H3/t15-,16-,21-,22-/m0/s1 |
| InChIKey | COPABOYARSNDCR-QDGJQWLKSA-N |
| XLogP | 7.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.51 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |