About 4-methylpiperidine-1-carboxylate;4-methylpiperidin-1-ium;hydrate
4-methylpiperidine-1-carboxylate;4-methylpiperidin-1-ium;hydrate (PubChem CID 139056878) has the molecular formula C13H28N2O3
and a molecular weight of 260.38 g/mol. Its IUPAC name is 4-methylpiperidine-1-carboxylate;4-methylpiperidin-1-ium;hydrate.
Molecular Properties
| Compound Name | 4-methylpiperidine-1-carboxylate;4-methylpiperidin-1-ium;hydrate |
| PubChem CID | 139056878 |
| Molecular Formula | C13H28N2O3 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 4-methylpiperidine-1-carboxylate;4-methylpiperidin-1-ium;hydrate |
| SMILES | CC1CCN(C(=O)[O-])CC1.CC1CC[NH2+]CC1.O |
| InChI | InChI=1S/C7H13NO2.C6H13N.H2O/c1-6-2-4-8(5-3-6)7(9)10;1-6-2-4-7-5-3-6;/h6H,2-5H2,1H3,(H,9,10);6-7H,2-5H2,1H3;1H2 |
| InChIKey | MOCAWKUJFYJNCR-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylpiperidine-1-carboxylate;4-methylpiperidin-1-ium;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpiperidine-1-carboxylate;4-methylpiperidin-1-ium;hydrate?
The IUPAC name of 4-methylpiperidine-1-carboxylate;4-methylpiperidin-1-ium;hydrate (CID 139056878) is 4-methylpiperidine-1-carboxylate;4-methylpiperidin-1-ium;hydrate.
What is the SMILES notation for 4-methylpiperidine-1-carboxylate;4-methylpiperidin-1-ium;hydrate?
The canonical SMILES for 4-methylpiperidine-1-carboxylate;4-methylpiperidin-1-ium;hydrate is CC1CCN(C(=O)[O-])CC1.CC1CC[NH2+]CC1.O.
What is the InChIKey of 4-methylpiperidine-1-carboxylate;4-methylpiperidin-1-ium;hydrate?
The InChIKey is MOCAWKUJFYJNCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C6H13N.H2O/c1-6-2-4-8(5-3-6)7(9)10;1-6-2-4-7-5-3-6;/h6H,2-5H2,1H3,(H,9,10);6-7H,2-5H2,1H3;1H2.
What are the key properties of 4-methylpiperidine-1-carboxylate;4-methylpiperidin-1-ium;hydrate?
4-methylpiperidine-1-carboxylate;4-methylpiperidin-1-ium;hydrate has a molecular weight of 260.38 g/mol, XLogP of -0.78, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpiperidine-1-carboxylate;4-methylpiperidin-1-ium;hydrate is sourced from PubChem (CID 139056878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).