C18H29NO2S — CID 139058148
dicyclohexylazanium;2-thiophen-3-ylacetate (PubChem CID 139058148) has the molecular formula C18H29NO2S and a molecular weight of 323.50 g/mol. Its IUPAC name is dicyclohexylazanium;2-thiophen-3-ylacetate.
| Compound Name | dicyclohexylazanium;2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 139058148 |
| Molecular Formula | C18H29NO2S |
| Molecular Weight | 323.50 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | dicyclohexylazanium;2-thiophen-3-ylacetate |
| SMILES | C1CCC([NH2+]C2CCCCC2)CC1.O=C([O-])Cc1ccsc1 |
| InChI | InChI=1S/C12H23N.C6H6O2S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;7-6(8)3-5-1-2-9-4-5/h11-13H,1-10H2;1-2,4H,3H2,(H,7,8) |
| InChIKey | POTSYVRTGXXYMX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |