About (E)-pent-2-enedioic acid;1H-pyridin-2-one
(E)-pent-2-enedioic acid;1H-pyridin-2-one (PubChem CID 139058194) has the molecular formula C10H11NO5
and a molecular weight of 225.20 g/mol. Its IUPAC name is (E)-pent-2-enedioic acid;1H-pyridin-2-one.
Molecular Properties
| Compound Name | (E)-pent-2-enedioic acid;1H-pyridin-2-one |
| PubChem CID | 139058194 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | (E)-pent-2-enedioic acid;1H-pyridin-2-one |
| SMILES | O=C(O)/C=C/CC(=O)O.O=c1cccc[nH]1 |
| InChI | InChI=1S/C5H5NO.C5H6O4/c7-5-3-1-2-4-6-5;6-4(7)2-1-3-5(8)9/h1-4H,(H,6,7);1-2H,3H2,(H,6,7)(H,8,9)/b;2-1+ |
| InChIKey | HVFXEJJNVAJFFE-WLHGVMLRSA-N |
| XLogP | 0.48 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-pent-2-enedioic acid;1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-pent-2-enedioic acid;1H-pyridin-2-one?
The IUPAC name of (E)-pent-2-enedioic acid;1H-pyridin-2-one (CID 139058194) is (E)-pent-2-enedioic acid;1H-pyridin-2-one.
What is the SMILES notation for (E)-pent-2-enedioic acid;1H-pyridin-2-one?
The canonical SMILES for (E)-pent-2-enedioic acid;1H-pyridin-2-one is O=C(O)/C=C/CC(=O)O.O=c1cccc[nH]1.
What is the InChIKey of (E)-pent-2-enedioic acid;1H-pyridin-2-one?
The InChIKey is HVFXEJJNVAJFFE-WLHGVMLRSA-N. The full InChI is InChI=1S/C5H5NO.C5H6O4/c7-5-3-1-2-4-6-5;6-4(7)2-1-3-5(8)9/h1-4H,(H,6,7);1-2H,3H2,(H,6,7)(H,8,9)/b;2-1+.
What are the key properties of (E)-pent-2-enedioic acid;1H-pyridin-2-one?
(E)-pent-2-enedioic acid;1H-pyridin-2-one has a molecular weight of 225.20 g/mol, XLogP of 0.48, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-pent-2-enedioic acid;1H-pyridin-2-one is sourced from PubChem (CID 139058194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).