C28H30N2O6 — CID 139058361
bis(acetonitrile);2,5,12,15,22,25-hexaoxatetracyclo[24.4.0.06,11.016,21]triaconta-1(30),6,8,10,16,18,20,26,28-nonaene (PubChem CID 139058361) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is bis(acetonitrile);2,5,12,15,22,25-hexaoxatetracyclo[24.4.0.06,11.016,21]triaconta-1(30),6,8,10,16,18,20,26,28-nonaene.
| Compound Name | bis(acetonitrile);2,5,12,15,22,25-hexaoxatetracyclo[24.4.0.06,11.016,21]triaconta-1(30),6,8,10,16,18,20,26,28-nonaene |
|---|---|
| PubChem CID | 139058361 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | bis(acetonitrile);2,5,12,15,22,25-hexaoxatetracyclo[24.4.0.06,11.016,21]triaconta-1(30),6,8,10,16,18,20,26,28-nonaene |
| SMILES | CC#N.CC#N.c1ccc2c(c1)OCCOc1ccccc1OCCOc1ccccc1OCCO2 |
| InChI | InChI=1S/C24H24O6.2C2H3N/c1-2-8-20-19(7-1)25-13-14-27-21-9-3-4-10-22(21)29-17-18-30-24-12-6-5-11-23(24)28-16-15-26-20;2*1-2-3/h1-12H,13-18H2;2*1H3 |
| InChIKey | WDGYVHMYZYLRSM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 102.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |