About bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);4-(2-pyridin-4-ylethyl)pyridine
bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);4-(2-pyridin-4-ylethyl)pyridine (PubChem CID 139058432) has the molecular formula C52H48N2O6
and a molecular weight of 796.96 g/mol. Its IUPAC name is bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);4-(2-pyridin-4-ylethyl)pyridine.
Molecular Properties
| Compound Name | bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);4-(2-pyridin-4-ylethyl)pyridine |
| PubChem CID | 139058432 |
| Molecular Formula | C52H48N2O6 |
| Molecular Weight | 796.96 g/mol |
| Exact Mass | 796.35 |
| IUPAC Name | bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);4-(2-pyridin-4-ylethyl)pyridine |
| SMILES | CC(c1ccc(O)cc1)(c1ccc(O)cc1)c1ccc(O)cc1.CC(c1ccc(O)cc1)(c1ccc(O)cc1)c1ccc(O)cc1.c1cc(CCc2ccncc2)ccn1 |
| InChI | InChI=1S/2C20H18O3.C12H12N2/c2*1-20(14-2-8-17(21)9-3-14,15-4-10-18(22)11-5-15)16-6-12-19(23)13-7-16;1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12/h2*2-13,21-23H,1H3;3-10H,1-2H2 |
| InChIKey | UIMLLHDYKQVBLT-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 147.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 796.96 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);4-(2-pyridin-4-ylethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);4-(2-pyridin-4-ylethyl)pyridine?
The IUPAC name of bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);4-(2-pyridin-4-ylethyl)pyridine (CID 139058432) is bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);4-(2-pyridin-4-ylethyl)pyridine.
What is the SMILES notation for bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);4-(2-pyridin-4-ylethyl)pyridine?
The canonical SMILES for bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);4-(2-pyridin-4-ylethyl)pyridine is CC(c1ccc(O)cc1)(c1ccc(O)cc1)c1ccc(O)cc1.CC(c1ccc(O)cc1)(c1ccc(O)cc1)c1ccc(O)cc1.c1cc(CCc2ccncc2)ccn1.
What is the InChIKey of bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);4-(2-pyridin-4-ylethyl)pyridine?
The InChIKey is UIMLLHDYKQVBLT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C20H18O3.C12H12N2/c2*1-20(14-2-8-17(21)9-3-14,15-4-10-18(22)11-5-15)16-6-12-19(23)13-7-16;1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12/h2*2-13,21-23H,1H3;3-10H,1-2H2.
What are the key properties of bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);4-(2-pyridin-4-ylethyl)pyridine?
bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);4-(2-pyridin-4-ylethyl)pyridine has a molecular weight of 796.96 g/mol, XLogP of 10.58, 9 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);4-(2-pyridin-4-ylethyl)pyridine is sourced from PubChem (CID 139058432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).