C33H32N2O4 — CID 139058433
4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol;methanol;4-[(E)-2-pyridin-4-ylethenyl]pyridine (PubChem CID 139058433) has the molecular formula C33H32N2O4 and a molecular weight of 520.63 g/mol. Its IUPAC name is 4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol;methanol;4-[(E)-2-pyridin-4-ylethenyl]pyridine.
| Compound Name | 4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol;methanol;4-[(E)-2-pyridin-4-ylethenyl]pyridine |
|---|---|
| PubChem CID | 139058433 |
| Molecular Formula | C33H32N2O4 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol;methanol;4-[(E)-2-pyridin-4-ylethenyl]pyridine |
| SMILES | C(=C/c1ccncc1)\c1ccncc1.CC(c1ccc(O)cc1)(c1ccc(O)cc1)c1ccc(O)cc1.CO |
| InChI | InChI=1S/C20H18O3.C12H10N2.CH4O/c1-20(14-2-8-17(21)9-3-14,15-4-10-18(22)11-5-15)16-6-12-19(23)13-7-16;1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;1-2/h2-13,21-23H,1H3;1-10H;2H,1H3/b;2-1+; |
| InChIKey | MIMRCFJHNLAMSQ-JITBQSAISA-N |
| XLogP | 6.41 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|