C50H44N2O6 — CID 139058543
bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);2-pyridin-2-ylpyridine (PubChem CID 139058543) has the molecular formula C50H44N2O6 and a molecular weight of 768.91 g/mol. Its IUPAC name is bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);2-pyridin-2-ylpyridine.
| Compound Name | bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);2-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 139058543 |
| Molecular Formula | C50H44N2O6 |
| Molecular Weight | 768.91 g/mol |
| Exact Mass | 768.32 |
| IUPAC Name | bis(4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol);2-pyridin-2-ylpyridine |
| SMILES | CC(c1ccc(O)cc1)(c1ccc(O)cc1)c1ccc(O)cc1.CC(c1ccc(O)cc1)(c1ccc(O)cc1)c1ccc(O)cc1.c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/2C20H18O3.C10H8N2/c2*1-20(14-2-8-17(21)9-3-14,15-4-10-18(22)11-5-15)16-6-12-19(23)13-7-16;1-3-7-11-9(5-1)10-6-2-4-8-12-10/h2*2-13,21-23H,1H3;1-8H |
| InChIKey | ZRBPUIHOEGTCJW-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 147.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.91 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|