C16H16O3 — CID 139058671
(10S)-2,2-dimethylspiro[3,4-dihydrobenzo[g]chromene-10,2'-oxirane]-5-one (PubChem CID 139058671) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is (10S)-2,2-dimethylspiro[3,4-dihydrobenzo[g]chromene-10,2'-oxirane]-5-one.
| Compound Name | (10S)-2,2-dimethylspiro[3,4-dihydrobenzo[g]chromene-10,2'-oxirane]-5-one |
|---|---|
| PubChem CID | 139058671 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (10S)-2,2-dimethylspiro[3,4-dihydrobenzo[g]chromene-10,2'-oxirane]-5-one |
| SMILES | CC1(C)CCC2=C(O1)[C@@]1(CO1)c1ccccc1C2=O |
| InChI | InChI=1S/C16H16O3/c1-15(2)8-7-11-13(17)10-5-3-4-6-12(10)16(9-18-16)14(11)19-15/h3-6H,7-9H2,1-2H3/t16-/m1/s1 |
| InChIKey | XGFZRMCJSKBFKE-MRXNPFEDSA-N |
| XLogP | 2.95 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|