C32H32N4O2 — CID 139059041
(2Z)-2-(1H-indol-3-ylmethylidene)-1-azabicyclo[2.2.2]octan-3-one (PubChem CID 139059041) has the molecular formula C32H32N4O2 and a molecular weight of 504.63 g/mol. Its IUPAC name is (2Z)-2-(1H-indol-3-ylmethylidene)-1-azabicyclo[2.2.2]octan-3-one.
| Compound Name | (2Z)-2-(1H-indol-3-ylmethylidene)-1-azabicyclo[2.2.2]octan-3-one |
|---|---|
| PubChem CID | 139059041 |
| Molecular Formula | C32H32N4O2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | (2Z)-2-(1H-indol-3-ylmethylidene)-1-azabicyclo[2.2.2]octan-3-one |
| SMILES | O=C1/C(=C/c2c[nH]c3ccccc23)N2CCC1CC2.O=C1/C(=C/c2c[nH]c3ccccc23)N2CCC1CC2 |
| InChI | InChI=1S/2C16H16N2O/c2*19-16-11-5-7-18(8-6-11)15(16)9-12-10-17-14-4-2-1-3-13(12)14/h2*1-4,9-11,17H,5-8H2/b2*15-9- |
| InChIKey | FHLAKDJJDNPEPK-YTXCYMDISA-N |
| XLogP | 5.61 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|