C30H52O2 — CID 139059301
(1R,4aR,8aR)-1,4a-dimethyl-7-propan-2-ylidene-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-ol (PubChem CID 139059301) has the molecular formula C30H52O2 and a molecular weight of 444.74 g/mol. Its IUPAC name is (1R,4aR,8aR)-1,4a-dimethyl-7-propan-2-ylidene-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-ol.
| Compound Name | (1R,4aR,8aR)-1,4a-dimethyl-7-propan-2-ylidene-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 139059301 |
| Molecular Formula | C30H52O2 |
| Molecular Weight | 444.74 g/mol |
| Exact Mass | 444.40 |
| IUPAC Name | (1R,4aR,8aR)-1,4a-dimethyl-7-propan-2-ylidene-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-ol |
| SMILES | CC(C)=C1CC[C@@]2(C)CCC[C@@](C)(O)[C@@H]2C1.CC(C)=C1CC[C@@]2(C)CCC[C@@](C)(O)[C@@H]2C1 |
| InChI | InChI=1S/2C15H26O/c2*1-11(2)12-6-9-14(3)7-5-8-15(4,16)13(14)10-12/h2*13,16H,5-10H2,1-4H3/t2*13-,14-,15-/m11/s1 |
| InChIKey | OEHZDBXPHCXHHA-DXHAQTLDSA-N |
| XLogP | 8.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.74 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|