About N-(7-bromoquinolin-4-yl)-N',N'-diethylethane-1,2-diamine;dihydrate
N-(7-bromoquinolin-4-yl)-N',N'-diethylethane-1,2-diamine;dihydrate (PubChem CID 139059335) has the molecular formula C15H24BrN3O2
and a molecular weight of 358.28 g/mol. Its IUPAC name is N-(7-bromoquinolin-4-yl)-N',N'-diethylethane-1,2-diamine;dihydrate.
Molecular Properties
| Compound Name | N-(7-bromoquinolin-4-yl)-N',N'-diethylethane-1,2-diamine;dihydrate |
| PubChem CID | 139059335 |
| Molecular Formula | C15H24BrN3O2 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-(7-bromoquinolin-4-yl)-N',N'-diethylethane-1,2-diamine;dihydrate |
| SMILES | CCN(CC)CCNc1ccnc2cc(Br)ccc12.O.O |
| InChI | InChI=1S/C15H20BrN3.2H2O/c1-3-19(4-2)10-9-18-14-7-8-17-15-11-12(16)5-6-13(14)15;;/h5-8,11H,3-4,9-10H2,1-2H3,(H,17,18);2*1H2 |
| InChIKey | CMXHJAOWQNLNDB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(7-bromoquinolin-4-yl)-N',N'-diethylethane-1,2-diamine;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-bromoquinolin-4-yl)-N',N'-diethylethane-1,2-diamine;dihydrate?
The IUPAC name of N-(7-bromoquinolin-4-yl)-N',N'-diethylethane-1,2-diamine;dihydrate (CID 139059335) is N-(7-bromoquinolin-4-yl)-N',N'-diethylethane-1,2-diamine;dihydrate.
What is the SMILES notation for N-(7-bromoquinolin-4-yl)-N',N'-diethylethane-1,2-diamine;dihydrate?
The canonical SMILES for N-(7-bromoquinolin-4-yl)-N',N'-diethylethane-1,2-diamine;dihydrate is CCN(CC)CCNc1ccnc2cc(Br)ccc12.O.O.
What is the InChIKey of N-(7-bromoquinolin-4-yl)-N',N'-diethylethane-1,2-diamine;dihydrate?
The InChIKey is CMXHJAOWQNLNDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20BrN3.2H2O/c1-3-19(4-2)10-9-18-14-7-8-17-15-11-12(16)5-6-13(14)15;;/h5-8,11H,3-4,9-10H2,1-2H3,(H,17,18);2*1H2.
What are the key properties of N-(7-bromoquinolin-4-yl)-N',N'-diethylethane-1,2-diamine;dihydrate?
N-(7-bromoquinolin-4-yl)-N',N'-diethylethane-1,2-diamine;dihydrate has a molecular weight of 358.28 g/mol, XLogP of 2.10, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-bromoquinolin-4-yl)-N',N'-diethylethane-1,2-diamine;dihydrate is sourced from PubChem (CID 139059335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).