About bis(4-azaniumylcyclohexane-1-carboxylate);hydrate
bis(4-azaniumylcyclohexane-1-carboxylate);hydrate (PubChem CID 139059415) has the molecular formula C14H28N2O5
and a molecular weight of 304.39 g/mol. Its IUPAC name is bis(4-azaniumylcyclohexane-1-carboxylate);hydrate.
Molecular Properties
| Compound Name | bis(4-azaniumylcyclohexane-1-carboxylate);hydrate |
| PubChem CID | 139059415 |
| Molecular Formula | C14H28N2O5 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | bis(4-azaniumylcyclohexane-1-carboxylate);hydrate |
| SMILES | O.[NH3+][C@H]1CC[C@@H](C(=O)[O-])CC1.[NH3+][C@H]1CC[C@H](C(=O)[O-])CC1 |
| InChI | InChI=1S/2C7H13NO2.H2O/c2*8-6-3-1-5(2-4-6)7(9)10;/h2*5-6H,1-4,8H2,(H,9,10);1H2/t5-,6+;5-,6-; |
| InChIKey | URQFLPAENPOYMK-GOXUJDCSSA-N |
| XLogP | -3.75 |
| TPSA | 167.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(4-azaniumylcyclohexane-1-carboxylate);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-azaniumylcyclohexane-1-carboxylate);hydrate?
The IUPAC name of bis(4-azaniumylcyclohexane-1-carboxylate);hydrate (CID 139059415) is bis(4-azaniumylcyclohexane-1-carboxylate);hydrate.
What is the SMILES notation for bis(4-azaniumylcyclohexane-1-carboxylate);hydrate?
The canonical SMILES for bis(4-azaniumylcyclohexane-1-carboxylate);hydrate is O.[NH3+][C@H]1CC[C@@H](C(=O)[O-])CC1.[NH3+][C@H]1CC[C@H](C(=O)[O-])CC1.
What is the InChIKey of bis(4-azaniumylcyclohexane-1-carboxylate);hydrate?
The InChIKey is URQFLPAENPOYMK-GOXUJDCSSA-N. The full InChI is InChI=1S/2C7H13NO2.H2O/c2*8-6-3-1-5(2-4-6)7(9)10;/h2*5-6H,1-4,8H2,(H,9,10);1H2/t5-,6+;5-,6-;.
What are the key properties of bis(4-azaniumylcyclohexane-1-carboxylate);hydrate?
bis(4-azaniumylcyclohexane-1-carboxylate);hydrate has a molecular weight of 304.39 g/mol, XLogP of -3.75, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-azaniumylcyclohexane-1-carboxylate);hydrate is sourced from PubChem (CID 139059415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).