C15H14ClN3S — CID 139059637
[5-(2-phenylphenyl)-1,3,4-thiadiazol-2-yl]methylazanium chloride (PubChem CID 139059637) has the molecular formula C15H14ClN3S and a molecular weight of 303.82 g/mol. Its IUPAC name is [5-(2-phenylphenyl)-1,3,4-thiadiazol-2-yl]methylazanium chloride.
| Compound Name | [5-(2-phenylphenyl)-1,3,4-thiadiazol-2-yl]methylazanium chloride |
|---|---|
| PubChem CID | 139059637 |
| Molecular Formula | C15H14ClN3S |
| Molecular Weight | 303.82 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | [5-(2-phenylphenyl)-1,3,4-thiadiazol-2-yl]methylazanium chloride |
| SMILES | [Cl-].[NH3+]Cc1nnc(-c2ccccc2-c2ccccc2)s1 |
| InChI | InChI=1S/C15H13N3S.ClH/c16-10-14-17-18-15(19-14)13-9-5-4-8-12(13)11-6-2-1-3-7-11;/h1-9H,10,16H2;1H |
| InChIKey | AFFAHMNYDZIEBS-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 53.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.82 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |