About 3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-2,6-diamine;hydrate
3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-2,6-diamine;hydrate (PubChem CID 139059675) has the molecular formula C12H15N3O7S
and a molecular weight of 345.33 g/mol. Its IUPAC name is 3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-2,6-diamine;hydrate.
Molecular Properties
| Compound Name | 3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-2,6-diamine;hydrate |
| PubChem CID | 139059675 |
| Molecular Formula | C12H15N3O7S |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-2,6-diamine;hydrate |
| SMILES | Nc1cccc(N)[nH+]1.O.O=C(O)c1cc(S(=O)(=O)[O-])ccc1O |
| InChI | InChI=1S/C7H6O6S.C5H7N3.H2O/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;6-4-2-1-3-5(7)8-4;/h1-3,8H,(H,9,10)(H,11,12,13);1-3H,(H4,6,7,8);1H2 |
| InChIKey | UGHCMVBKFYTZFJ-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 212.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-2,6-diamine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-2,6-diamine;hydrate?
The IUPAC name of 3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-2,6-diamine;hydrate (CID 139059675) is 3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-2,6-diamine;hydrate.
What is the SMILES notation for 3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-2,6-diamine;hydrate?
The canonical SMILES for 3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-2,6-diamine;hydrate is Nc1cccc(N)[nH+]1.O.O=C(O)c1cc(S(=O)(=O)[O-])ccc1O.
What is the InChIKey of 3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-2,6-diamine;hydrate?
The InChIKey is UGHCMVBKFYTZFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O6S.C5H7N3.H2O/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;6-4-2-1-3-5(7)8-4;/h1-3,8H,(H,9,10)(H,11,12,13);1-3H,(H4,6,7,8);1H2.
What are the key properties of 3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-2,6-diamine;hydrate?
3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-2,6-diamine;hydrate has a molecular weight of 345.33 g/mol, XLogP of -1.17, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-2,6-diamine;hydrate is sourced from PubChem (CID 139059675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).