C57H41N5O8Zn — CID 139059752
methyl 4-[10,15,20-tris(4-methoxycarbonylphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraid-5-yl]benzoate;pyridine;zinc (PubChem CID 139059752) has the molecular formula C57H41N5O8Zn and a molecular weight of 989.37 g/mol. Its IUPAC name is methyl 4-[10,15,20-tris(4-methoxycarbonylphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraid-5-yl]benzoate;pyridine;zinc.
| Compound Name | methyl 4-[10,15,20-tris(4-methoxycarbonylphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraid-5-yl]benzoate;pyridine;zinc |
|---|---|
| PubChem CID | 139059752 |
| Molecular Formula | C57H41N5O8Zn |
| Molecular Weight | 989.37 g/mol |
| Exact Mass | 987.22 |
| IUPAC Name | methyl 4-[10,15,20-tris(4-methoxycarbonylphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraid-5-yl]benzoate;pyridine;zinc |
| SMILES | COC(=O)c1ccc([C+]2c3ccc([n-]3)[C+](c3ccc(C(=O)OC)cc3)c3ccc([n-]3)[C+](c3ccc(C(=O)OC)cc3)c3ccc([n-]3)[C+](c3ccc(C(=O)OC)cc3)c3ccc2[n-]3)cc1.[Zn].c1ccncc1 |
| InChI | InChI=1S/C52H36N4O8.C5H5N.Zn/c1-61-49(57)33-13-5-29(6-14-33)45-37-21-23-39(53-37)46(30-7-15-34(16-8-30)50(58)62-2)41-25-27-43(55-41)48(32-11-19-36(20-12-32)52(60)64-4)44-28-26-42(56-44)47(40-24-22-38(45)54-40)31-9-17-35(18-10-31)51(59)63-3;1-2-4-6-5-3-1;/h5-28H,1-4H3;1-5H; |
| InChIKey | ZLPHNIYGBTXBIH-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 174.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 989.37 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|