About (2R)-pyrrolidin-1-ium-2-carboxylic acid;2,4,6-trinitrophenolate
(2R)-pyrrolidin-1-ium-2-carboxylic acid;2,4,6-trinitrophenolate (PubChem CID 139059910) has the molecular formula C11H12N4O9
and a molecular weight of 344.24 g/mol. Its IUPAC name is (2R)-pyrrolidin-1-ium-2-carboxylic acid;2,4,6-trinitrophenolate.
Molecular Properties
| Compound Name | (2R)-pyrrolidin-1-ium-2-carboxylic acid;2,4,6-trinitrophenolate |
| PubChem CID | 139059910 |
| Molecular Formula | C11H12N4O9 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | (2R)-pyrrolidin-1-ium-2-carboxylic acid;2,4,6-trinitrophenolate |
| SMILES | O=C(O)[C@H]1CCC[NH2+]1.O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3N3O7.C5H9NO2/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;7-5(8)4-2-1-3-6-4/h1-2,10H;4,6H,1-3H2,(H,7,8)/t;4-/m.1/s1 |
| InChIKey | URLYMVAPXRVBNL-FZSMXKCYSA-N |
| XLogP | -0.72 |
| TPSA | 206.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-pyrrolidin-1-ium-2-carboxylic acid;2,4,6-trinitrophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-pyrrolidin-1-ium-2-carboxylic acid;2,4,6-trinitrophenolate?
The IUPAC name of (2R)-pyrrolidin-1-ium-2-carboxylic acid;2,4,6-trinitrophenolate (CID 139059910) is (2R)-pyrrolidin-1-ium-2-carboxylic acid;2,4,6-trinitrophenolate.
What is the SMILES notation for (2R)-pyrrolidin-1-ium-2-carboxylic acid;2,4,6-trinitrophenolate?
The canonical SMILES for (2R)-pyrrolidin-1-ium-2-carboxylic acid;2,4,6-trinitrophenolate is O=C(O)[C@H]1CCC[NH2+]1.O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1.
What is the InChIKey of (2R)-pyrrolidin-1-ium-2-carboxylic acid;2,4,6-trinitrophenolate?
The InChIKey is URLYMVAPXRVBNL-FZSMXKCYSA-N. The full InChI is InChI=1S/C6H3N3O7.C5H9NO2/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;7-5(8)4-2-1-3-6-4/h1-2,10H;4,6H,1-3H2,(H,7,8)/t;4-/m.1/s1.
What are the key properties of (2R)-pyrrolidin-1-ium-2-carboxylic acid;2,4,6-trinitrophenolate?
(2R)-pyrrolidin-1-ium-2-carboxylic acid;2,4,6-trinitrophenolate has a molecular weight of 344.24 g/mol, XLogP of -0.72, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-pyrrolidin-1-ium-2-carboxylic acid;2,4,6-trinitrophenolate is sourced from PubChem (CID 139059910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).