C9H12Br2O3 — CID 139059969
ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate (PubChem CID 139059969) has the molecular formula C9H12Br2O3 and a molecular weight of 328.00 g/mol. Its IUPAC name is ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate |
|---|---|
| PubChem CID | 139059969 |
| Molecular Formula | C9H12Br2O3 |
| Molecular Weight | 328.00 g/mol |
| Exact Mass | 325.92 |
| IUPAC Name | ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate |
| SMILES | CCOC(=O)/C(Br)=C1/O[C@@H](C)C[C@@H]1Br |
| InChI | InChI=1S/C9H12Br2O3/c1-3-13-9(12)7(11)8-6(10)4-5(2)14-8/h5-6H,3-4H2,1-2H3/b8-7-/t5-,6-/m0/s1 |
| InChIKey | JPLKNLJYUSWRDW-PZDQFLETSA-N |
| XLogP | 2.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.00 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|