About (3,5-dimethyl-1H-pyrazol-4-yl)methyl-propan-2-ylazanium;chloride;hydrate
(3,5-dimethyl-1H-pyrazol-4-yl)methyl-propan-2-ylazanium;chloride;hydrate (PubChem CID 139060191) has the molecular formula C9H20ClN3O
and a molecular weight of 221.73 g/mol. Its IUPAC name is (3,5-dimethyl-1H-pyrazol-4-yl)methyl-propan-2-ylazanium;chloride;hydrate.
Molecular Properties
| Compound Name | (3,5-dimethyl-1H-pyrazol-4-yl)methyl-propan-2-ylazanium;chloride;hydrate |
| PubChem CID | 139060191 |
| Molecular Formula | C9H20ClN3O |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | (3,5-dimethyl-1H-pyrazol-4-yl)methyl-propan-2-ylazanium;chloride;hydrate |
| SMILES | Cc1n[nH]c(C)c1C[NH2+]C(C)C.O.[Cl-] |
| InChI | InChI=1S/C9H17N3.ClH.H2O/c1-6(2)10-5-9-7(3)11-12-8(9)4;;/h6,10H,5H2,1-4H3,(H,11,12);1H;1H2 |
| InChIKey | JSLJTWIFEIQKIB-UHFFFAOYSA-N |
| XLogP | -3.32 |
| TPSA | 76.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3,5-dimethyl-1H-pyrazol-4-yl)methyl-propan-2-ylazanium;chloride;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethyl-1H-pyrazol-4-yl)methyl-propan-2-ylazanium;chloride;hydrate?
The IUPAC name of (3,5-dimethyl-1H-pyrazol-4-yl)methyl-propan-2-ylazanium;chloride;hydrate (CID 139060191) is (3,5-dimethyl-1H-pyrazol-4-yl)methyl-propan-2-ylazanium;chloride;hydrate.
What is the SMILES notation for (3,5-dimethyl-1H-pyrazol-4-yl)methyl-propan-2-ylazanium;chloride;hydrate?
The canonical SMILES for (3,5-dimethyl-1H-pyrazol-4-yl)methyl-propan-2-ylazanium;chloride;hydrate is Cc1n[nH]c(C)c1C[NH2+]C(C)C.O.[Cl-].
What is the InChIKey of (3,5-dimethyl-1H-pyrazol-4-yl)methyl-propan-2-ylazanium;chloride;hydrate?
The InChIKey is JSLJTWIFEIQKIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3.ClH.H2O/c1-6(2)10-5-9-7(3)11-12-8(9)4;;/h6,10H,5H2,1-4H3,(H,11,12);1H;1H2.
What are the key properties of (3,5-dimethyl-1H-pyrazol-4-yl)methyl-propan-2-ylazanium;chloride;hydrate?
(3,5-dimethyl-1H-pyrazol-4-yl)methyl-propan-2-ylazanium;chloride;hydrate has a molecular weight of 221.73 g/mol, XLogP of -3.32, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethyl-1H-pyrazol-4-yl)methyl-propan-2-ylazanium;chloride;hydrate is sourced from PubChem (CID 139060191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).