C19H18N2O7S — CID 139060202
4-carboxybenzenesulfonate;1,10-phenanthrolin-10-ium;dihydrate (PubChem CID 139060202) has the molecular formula C19H18N2O7S and a molecular weight of 418.43 g/mol. Its IUPAC name is 4-carboxybenzenesulfonate;1,10-phenanthrolin-10-ium;dihydrate.
| Compound Name | 4-carboxybenzenesulfonate;1,10-phenanthrolin-10-ium;dihydrate |
|---|---|
| PubChem CID | 139060202 |
| Molecular Formula | C19H18N2O7S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 4-carboxybenzenesulfonate;1,10-phenanthrolin-10-ium;dihydrate |
| SMILES | O.O.O=C(O)c1ccc(S(=O)(=O)[O-])cc1.c1cnc2c(c1)ccc1ccc[nH+]c12 |
| InChI | InChI=1S/C12H8N2.C7H6O5S.2H2O/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;8-7(9)5-1-3-6(4-2-5)13(10,11)12;;/h1-8H;1-4H,(H,8,9)(H,10,11,12);2*1H2 |
| InChIKey | RFMDFWJWKNGHCZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 184.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|