C20H21N5O2 — CID 139060362
9-ethyl-4,11-diphenyl-1,3,5,7,9-pentazatricyclo[5.3.1.04,11]undecane-2,6-dione (PubChem CID 139060362) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 9-ethyl-4,11-diphenyl-1,3,5,7,9-pentazatricyclo[5.3.1.04,11]undecane-2,6-dione.
| Compound Name | 9-ethyl-4,11-diphenyl-1,3,5,7,9-pentazatricyclo[5.3.1.04,11]undecane-2,6-dione |
|---|---|
| PubChem CID | 139060362 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 9-ethyl-4,11-diphenyl-1,3,5,7,9-pentazatricyclo[5.3.1.04,11]undecane-2,6-dione |
| SMILES | CCN1CN2C(=O)NC3(c4ccccc4)NC(=O)N(C1)C23c1ccccc1 |
| InChI | InChI=1S/C20H21N5O2/c1-2-23-13-24-17(26)21-19(15-9-5-3-6-10-15)20(24,16-11-7-4-8-12-16)25(14-23)18(27)22-19/h3-12H,2,13-14H2,1H3,(H,21,26)(H,22,27) |
| InChIKey | ZMTQOBJEHKWIFI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |