About 4-[(E)-2-(3-methoxyphenyl)ethenyl]-1-methylpyridin-1-ium;tetraphenylboranuide
4-[(E)-2-(3-methoxyphenyl)ethenyl]-1-methylpyridin-1-ium;tetraphenylboranuide (PubChem CID 139060371) has the molecular formula C39H36BNO
and a molecular weight of 545.54 g/mol. Its IUPAC name is 4-[(E)-2-(3-methoxyphenyl)ethenyl]-1-methylpyridin-1-ium;tetraphenylboranuide.
Molecular Properties
| Compound Name | 4-[(E)-2-(3-methoxyphenyl)ethenyl]-1-methylpyridin-1-ium;tetraphenylboranuide |
| PubChem CID | 139060371 |
| Molecular Formula | C39H36BNO |
| Molecular Weight | 545.54 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | 4-[(E)-2-(3-methoxyphenyl)ethenyl]-1-methylpyridin-1-ium;tetraphenylboranuide |
| SMILES | COc1cccc(/C=C/c2cc[n+](C)cc2)c1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C15H16NO/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-16-10-8-13(9-11-16)6-7-14-4-3-5-15(12-14)17-2/h1-20H;3-12H,1-2H3/q-1;+1/b;7-6+ |
| InChIKey | NXUADZSZGQOJCE-UETGHTDLSA-N |
| XLogP | 5.75 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 545.54 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-(3-methoxyphenyl)ethenyl]-1-methylpyridin-1-ium;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-(3-methoxyphenyl)ethenyl]-1-methylpyridin-1-ium;tetraphenylboranuide?
The IUPAC name of 4-[(E)-2-(3-methoxyphenyl)ethenyl]-1-methylpyridin-1-ium;tetraphenylboranuide (CID 139060371) is 4-[(E)-2-(3-methoxyphenyl)ethenyl]-1-methylpyridin-1-ium;tetraphenylboranuide.
What is the SMILES notation for 4-[(E)-2-(3-methoxyphenyl)ethenyl]-1-methylpyridin-1-ium;tetraphenylboranuide?
The canonical SMILES for 4-[(E)-2-(3-methoxyphenyl)ethenyl]-1-methylpyridin-1-ium;tetraphenylboranuide is COc1cccc(/C=C/c2cc[n+](C)cc2)c1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 4-[(E)-2-(3-methoxyphenyl)ethenyl]-1-methylpyridin-1-ium;tetraphenylboranuide?
The InChIKey is NXUADZSZGQOJCE-UETGHTDLSA-N. The full InChI is InChI=1S/C24H20B.C15H16NO/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-16-10-8-13(9-11-16)6-7-14-4-3-5-15(12-14)17-2/h1-20H;3-12H,1-2H3/q-1;+1/b;7-6+.
What are the key properties of 4-[(E)-2-(3-methoxyphenyl)ethenyl]-1-methylpyridin-1-ium;tetraphenylboranuide?
4-[(E)-2-(3-methoxyphenyl)ethenyl]-1-methylpyridin-1-ium;tetraphenylboranuide has a molecular weight of 545.54 g/mol, XLogP of 5.75, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-(3-methoxyphenyl)ethenyl]-1-methylpyridin-1-ium;tetraphenylboranuide is sourced from PubChem (CID 139060371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).