About adamantane-1,3-dicarboxylic acid;4-pyridin-4-ylpyridine
adamantane-1,3-dicarboxylic acid;4-pyridin-4-ylpyridine (PubChem CID 139060374) has the molecular formula C22H24N2O4
and a molecular weight of 380.44 g/mol. Its IUPAC name is adamantane-1,3-dicarboxylic acid;4-pyridin-4-ylpyridine.
Molecular Properties
| Compound Name | adamantane-1,3-dicarboxylic acid;4-pyridin-4-ylpyridine |
| PubChem CID | 139060374 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | adamantane-1,3-dicarboxylic acid;4-pyridin-4-ylpyridine |
| SMILES | O=C(O)C12CC3CC(C1)CC(C(=O)O)(C3)C2.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C12H16O4.C10H8N2/c13-9(14)11-2-7-1-8(4-11)5-12(3-7,6-11)10(15)16;1-5-11-6-2-9(1)10-3-7-12-8-4-10/h7-8H,1-6H2,(H,13,14)(H,15,16);1-8H |
| InChIKey | XQLMZAYHNXSLKC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze adamantane-1,3-dicarboxylic acid;4-pyridin-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane-1,3-dicarboxylic acid;4-pyridin-4-ylpyridine?
The IUPAC name of adamantane-1,3-dicarboxylic acid;4-pyridin-4-ylpyridine (CID 139060374) is adamantane-1,3-dicarboxylic acid;4-pyridin-4-ylpyridine.
What is the SMILES notation for adamantane-1,3-dicarboxylic acid;4-pyridin-4-ylpyridine?
The canonical SMILES for adamantane-1,3-dicarboxylic acid;4-pyridin-4-ylpyridine is O=C(O)C12CC3CC(C1)CC(C(=O)O)(C3)C2.c1cc(-c2ccncc2)ccn1.
What is the InChIKey of adamantane-1,3-dicarboxylic acid;4-pyridin-4-ylpyridine?
The InChIKey is XQLMZAYHNXSLKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4.C10H8N2/c13-9(14)11-2-7-1-8(4-11)5-12(3-7,6-11)10(15)16;1-5-11-6-2-9(1)10-3-7-12-8-4-10/h7-8H,1-6H2,(H,13,14)(H,15,16);1-8H.
What are the key properties of adamantane-1,3-dicarboxylic acid;4-pyridin-4-ylpyridine?
adamantane-1,3-dicarboxylic acid;4-pyridin-4-ylpyridine has a molecular weight of 380.44 g/mol, XLogP of 3.89, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane-1,3-dicarboxylic acid;4-pyridin-4-ylpyridine is sourced from PubChem (CID 139060374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).