About zinc;bis((Z)-4-oxopent-2-en-2-olate);2-pyridin-2-ylpyridine
zinc;bis((Z)-4-oxopent-2-en-2-olate);2-pyridin-2-ylpyridine (PubChem CID 139060389) has the molecular formula C20H22N2O4Zn
and a molecular weight of 419.80 g/mol. Its IUPAC name is zinc;bis((Z)-4-oxopent-2-en-2-olate);2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | zinc;bis((Z)-4-oxopent-2-en-2-olate);2-pyridin-2-ylpyridine |
| PubChem CID | 139060389 |
| Molecular Formula | C20H22N2O4Zn |
| Molecular Weight | 419.80 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | zinc;bis((Z)-4-oxopent-2-en-2-olate);2-pyridin-2-ylpyridine |
| SMILES | CC(=O)/C=C(/C)[O-].CC(=O)/C=C(/C)[O-].[Zn+2].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.2C5H8O2.Zn/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2*1-4(6)3-5(2)7;/h1-8H;2*3,6H,1-2H3;/q;;;+2/p-2/b;2*4-3-; |
| InChIKey | NZLJQZWXGFXTEA-QDMRRLORSA-L |
| XLogP | 1.82 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.80 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze zinc;bis((Z)-4-oxopent-2-en-2-olate);2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;bis((Z)-4-oxopent-2-en-2-olate);2-pyridin-2-ylpyridine?
The IUPAC name of zinc;bis((Z)-4-oxopent-2-en-2-olate);2-pyridin-2-ylpyridine (CID 139060389) is zinc;bis((Z)-4-oxopent-2-en-2-olate);2-pyridin-2-ylpyridine.
What is the SMILES notation for zinc;bis((Z)-4-oxopent-2-en-2-olate);2-pyridin-2-ylpyridine?
The canonical SMILES for zinc;bis((Z)-4-oxopent-2-en-2-olate);2-pyridin-2-ylpyridine is CC(=O)/C=C(/C)[O-].CC(=O)/C=C(/C)[O-].[Zn+2].c1ccc(-c2ccccn2)nc1.
What is the InChIKey of zinc;bis((Z)-4-oxopent-2-en-2-olate);2-pyridin-2-ylpyridine?
The InChIKey is NZLJQZWXGFXTEA-QDMRRLORSA-L. The full InChI is InChI=1S/C10H8N2.2C5H8O2.Zn/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2*1-4(6)3-5(2)7;/h1-8H;2*3,6H,1-2H3;/q;;;+2/p-2/b;2*4-3-;.
What are the key properties of zinc;bis((Z)-4-oxopent-2-en-2-olate);2-pyridin-2-ylpyridine?
zinc;bis((Z)-4-oxopent-2-en-2-olate);2-pyridin-2-ylpyridine has a molecular weight of 419.80 g/mol, XLogP of 1.82, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;bis((Z)-4-oxopent-2-en-2-olate);2-pyridin-2-ylpyridine is sourced from PubChem (CID 139060389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).