About 6-bromo-9-ethyl-1,4-dimethylcarbazole
6-bromo-9-ethyl-1,4-dimethylcarbazole (PubChem CID 139060494) has the molecular formula C32H32Br2N2
and a molecular weight of 604.43 g/mol. Its IUPAC name is 6-bromo-9-ethyl-1,4-dimethylcarbazole.
Molecular Properties
| Compound Name | 6-bromo-9-ethyl-1,4-dimethylcarbazole |
| PubChem CID | 139060494 |
| Molecular Formula | C32H32Br2N2 |
| Molecular Weight | 604.43 g/mol |
| Exact Mass | 602.09 |
| IUPAC Name | 6-bromo-9-ethyl-1,4-dimethylcarbazole |
| SMILES | CCn1c2ccc(Br)cc2c2c(C)ccc(C)c21.CCn1c2ccc(Br)cc2c2c(C)ccc(C)c21 |
| InChI | InChI=1S/2C16H16BrN/c2*1-4-18-14-8-7-12(17)9-13(14)15-10(2)5-6-11(3)16(15)18/h2*5-9H,4H2,1-3H3 |
| InChIKey | RZUHFJDZBGLCSB-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 604.43 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-9-ethyl-1,4-dimethylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-9-ethyl-1,4-dimethylcarbazole?
The IUPAC name of 6-bromo-9-ethyl-1,4-dimethylcarbazole (CID 139060494) is 6-bromo-9-ethyl-1,4-dimethylcarbazole.
What is the SMILES notation for 6-bromo-9-ethyl-1,4-dimethylcarbazole?
The canonical SMILES for 6-bromo-9-ethyl-1,4-dimethylcarbazole is CCn1c2ccc(Br)cc2c2c(C)ccc(C)c21.CCn1c2ccc(Br)cc2c2c(C)ccc(C)c21.
What is the InChIKey of 6-bromo-9-ethyl-1,4-dimethylcarbazole?
The InChIKey is RZUHFJDZBGLCSB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H16BrN/c2*1-4-18-14-8-7-12(17)9-13(14)15-10(2)5-6-11(3)16(15)18/h2*5-9H,4H2,1-3H3.
What are the key properties of 6-bromo-9-ethyl-1,4-dimethylcarbazole?
6-bromo-9-ethyl-1,4-dimethylcarbazole has a molecular weight of 604.43 g/mol, XLogP of 10.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-9-ethyl-1,4-dimethylcarbazole is sourced from PubChem (CID 139060494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).