C12H14FNO — CID 139060612
(2S,4R)-2-ethenyl-7-fluoro-2,3,4,5-tetrahydro-1H-1-benzazepin-4-ol (PubChem CID 139060612) has the molecular formula C12H14FNO and a molecular weight of 207.25 g/mol. Its IUPAC name is (2S,4R)-2-ethenyl-7-fluoro-2,3,4,5-tetrahydro-1H-1-benzazepin-4-ol.
| Compound Name | (2S,4R)-2-ethenyl-7-fluoro-2,3,4,5-tetrahydro-1H-1-benzazepin-4-ol |
|---|---|
| PubChem CID | 139060612 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | (2S,4R)-2-ethenyl-7-fluoro-2,3,4,5-tetrahydro-1H-1-benzazepin-4-ol |
| SMILES | C=C[C@@H]1C[C@H](O)Cc2cc(F)ccc2N1 |
| InChI | InChI=1S/C12H14FNO/c1-2-10-7-11(15)6-8-5-9(13)3-4-12(8)14-10/h2-5,10-11,14-15H,1,6-7H2/t10-,11-/m1/s1 |
| InChIKey | WSVWRVWJJDMASG-GHMZBOCLSA-N |
| XLogP | 2.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|