C12H8Cl2N2O5 — CID 139060670
2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;pyridin-1-ium-3-carboxamide (PubChem CID 139060670) has the molecular formula C12H8Cl2N2O5 and a molecular weight of 331.11 g/mol. Its IUPAC name is 2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;pyridin-1-ium-3-carboxamide.
| Compound Name | 2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 139060670 |
| Molecular Formula | C12H8Cl2N2O5 |
| Molecular Weight | 331.11 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;pyridin-1-ium-3-carboxamide |
| SMILES | NC(=O)c1ccc[nH+]c1.O=C1C(O)=C(Cl)C(=O)C([O-])=C1Cl |
| InChI | InChI=1S/C6H2Cl2O4.C6H6N2O/c7-1-3(9)5(11)2(8)6(12)4(1)10;7-6(9)5-2-1-3-8-4-5/h9,12H;1-4H,(H2,7,9) |
| InChIKey | UMUZARIZOIFZGL-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.11 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|