C18H20O10S — CID 139060698
[(1S,5R,6S,8R)-8-acetyloxy-9-(4-methylphenyl)sulfonyloxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] acetate (PubChem CID 139060698) has the molecular formula C18H20O10S and a molecular weight of 428.42 g/mol. Its IUPAC name is [(1S,5R,6S,8R)-8-acetyloxy-9-(4-methylphenyl)sulfonyloxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] acetate.
| Compound Name | [(1S,5R,6S,8R)-8-acetyloxy-9-(4-methylphenyl)sulfonyloxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] acetate |
|---|---|
| PubChem CID | 139060698 |
| Molecular Formula | C18H20O10S |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | [(1S,5R,6S,8R)-8-acetyloxy-9-(4-methylphenyl)sulfonyloxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C2OC3O[C@@H]1C(OS(=O)(=O)c1ccc(C)cc1)[C@H](O3)[C@H]2OC(C)=O |
| InChI | InChI=1S/C18H20O10S/c1-8-4-6-11(7-5-8)29(21,22)28-17-15-12(23-9(2)19)14-13(24-10(3)20)16(17)27-18(25-14)26-15/h4-7,12-18H,1-3H3/t12-,13+,14?,15+,16-,17?,18? |
| InChIKey | NGNRWGSWZWDRMX-OCKZGPCRSA-N |
| XLogP | 0.41 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|