About 2-[(2-carboxylatophenyl)disulfanyl]benzoate;bis(1H-imidazol-3-ium)
2-[(2-carboxylatophenyl)disulfanyl]benzoate;bis(1H-imidazol-3-ium) (PubChem CID 139060745) has the molecular formula C20H18N4O4S2
and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-[(2-carboxylatophenyl)disulfanyl]benzoate;bis(1H-imidazol-3-ium).
Molecular Properties
| Compound Name | 2-[(2-carboxylatophenyl)disulfanyl]benzoate;bis(1H-imidazol-3-ium) |
| PubChem CID | 139060745 |
| Molecular Formula | C20H18N4O4S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-[(2-carboxylatophenyl)disulfanyl]benzoate;bis(1H-imidazol-3-ium) |
| SMILES | O=C([O-])c1ccccc1SSc1ccccc1C(=O)[O-].c1c[nH+]c[nH]1.c1c[nH+]c[nH]1 |
| InChI | InChI=1S/C14H10O4S2.2C3H4N2/c15-13(16)9-5-1-3-7-11(9)19-20-12-8-4-2-6-10(12)14(17)18;2*1-2-5-3-4-1/h1-8H,(H,15,16)(H,17,18);2*1-3H,(H,4,5) |
| InChIKey | SHXLLQMZEYRIQO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 140.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-carboxylatophenyl)disulfanyl]benzoate;bis(1H-imidazol-3-ium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-carboxylatophenyl)disulfanyl]benzoate;bis(1H-imidazol-3-ium)?
The IUPAC name of 2-[(2-carboxylatophenyl)disulfanyl]benzoate;bis(1H-imidazol-3-ium) (CID 139060745) is 2-[(2-carboxylatophenyl)disulfanyl]benzoate;bis(1H-imidazol-3-ium).
What is the SMILES notation for 2-[(2-carboxylatophenyl)disulfanyl]benzoate;bis(1H-imidazol-3-ium)?
The canonical SMILES for 2-[(2-carboxylatophenyl)disulfanyl]benzoate;bis(1H-imidazol-3-ium) is O=C([O-])c1ccccc1SSc1ccccc1C(=O)[O-].c1c[nH+]c[nH]1.c1c[nH+]c[nH]1.
What is the InChIKey of 2-[(2-carboxylatophenyl)disulfanyl]benzoate;bis(1H-imidazol-3-ium)?
The InChIKey is SHXLLQMZEYRIQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O4S2.2C3H4N2/c15-13(16)9-5-1-3-7-11(9)19-20-12-8-4-2-6-10(12)14(17)18;2*1-2-5-3-4-1/h1-8H,(H,15,16)(H,17,18);2*1-3H,(H,4,5).
What are the key properties of 2-[(2-carboxylatophenyl)disulfanyl]benzoate;bis(1H-imidazol-3-ium)?
2-[(2-carboxylatophenyl)disulfanyl]benzoate;bis(1H-imidazol-3-ium) has a molecular weight of 442.52 g/mol, XLogP of 0.87, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-carboxylatophenyl)disulfanyl]benzoate;bis(1H-imidazol-3-ium) is sourced from PubChem (CID 139060745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).