About bis(6-(5-carboxy-2-pyridinyl)pyridine-3-carboxylate);lead(2+)
bis(6-(5-carboxy-2-pyridinyl)pyridine-3-carboxylate);lead(2+) (PubChem CID 139060823) has the molecular formula C24H14N4O8Pb
and a molecular weight of 693.60 g/mol. Its IUPAC name is bis(6-(5-carboxy-2-pyridinyl)pyridine-3-carboxylate);lead(2+).
Molecular Properties
| Compound Name | bis(6-(5-carboxy-2-pyridinyl)pyridine-3-carboxylate);lead(2+) |
| PubChem CID | 139060823 |
| Molecular Formula | C24H14N4O8Pb |
| Molecular Weight | 693.60 g/mol |
| Exact Mass | 694.06 |
| IUPAC Name | bis(6-(5-carboxy-2-pyridinyl)pyridine-3-carboxylate);lead(2+) |
| SMILES | O=C([O-])c1ccc(-c2ccc(C(=O)O)cn2)nc1.O=C([O-])c1ccc(-c2ccc(C(=O)O)cn2)nc1.[Pb+2] |
| InChI | InChI=1S/2C12H8N2O4.Pb/c2*15-11(16)7-1-3-9(13-5-7)10-4-2-8(6-14-10)12(17)18;/h2*1-6H,(H,15,16)(H,17,18);/q;;+2/p-2 |
| InChIKey | PCVJPPGOYUJAAK-UHFFFAOYSA-L |
| XLogP | 0.03 |
| TPSA | 206.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 693.60 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze bis(6-(5-carboxy-2-pyridinyl)pyridine-3-carboxylate);lead(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(6-(5-carboxy-2-pyridinyl)pyridine-3-carboxylate);lead(2+)?
The IUPAC name of bis(6-(5-carboxy-2-pyridinyl)pyridine-3-carboxylate);lead(2+) (CID 139060823) is bis(6-(5-carboxy-2-pyridinyl)pyridine-3-carboxylate);lead(2+).
What is the SMILES notation for bis(6-(5-carboxy-2-pyridinyl)pyridine-3-carboxylate);lead(2+)?
The canonical SMILES for bis(6-(5-carboxy-2-pyridinyl)pyridine-3-carboxylate);lead(2+) is O=C([O-])c1ccc(-c2ccc(C(=O)O)cn2)nc1.O=C([O-])c1ccc(-c2ccc(C(=O)O)cn2)nc1.[Pb+2].
What is the InChIKey of bis(6-(5-carboxy-2-pyridinyl)pyridine-3-carboxylate);lead(2+)?
The InChIKey is PCVJPPGOYUJAAK-UHFFFAOYSA-L. The full InChI is InChI=1S/2C12H8N2O4.Pb/c2*15-11(16)7-1-3-9(13-5-7)10-4-2-8(6-14-10)12(17)18;/h2*1-6H,(H,15,16)(H,17,18);/q;;+2/p-2.
What are the key properties of bis(6-(5-carboxy-2-pyridinyl)pyridine-3-carboxylate);lead(2+)?
bis(6-(5-carboxy-2-pyridinyl)pyridine-3-carboxylate);lead(2+) has a molecular weight of 693.60 g/mol, XLogP of 0.03, 6 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(6-(5-carboxy-2-pyridinyl)pyridine-3-carboxylate);lead(2+) is sourced from PubChem (CID 139060823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).