C14H10Cl4N2O4 — CID 139061148
2-carboxy-3,4,5,6-tetrachlorobenzoate;6-methylpyridin-1-ium-2-amine (PubChem CID 139061148) has the molecular formula C14H10Cl4N2O4 and a molecular weight of 412.06 g/mol. Its IUPAC name is 2-carboxy-3,4,5,6-tetrachlorobenzoate;6-methylpyridin-1-ium-2-amine.
| Compound Name | 2-carboxy-3,4,5,6-tetrachlorobenzoate;6-methylpyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 139061148 |
| Molecular Formula | C14H10Cl4N2O4 |
| Molecular Weight | 412.06 g/mol |
| Exact Mass | 409.94 |
| IUPAC Name | 2-carboxy-3,4,5,6-tetrachlorobenzoate;6-methylpyridin-1-ium-2-amine |
| SMILES | Cc1cccc(N)[nH+]1.O=C([O-])c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)O |
| InChI | InChI=1S/C8H2Cl4O4.C6H8N2/c9-3-1(7(13)14)2(8(15)16)4(10)6(12)5(3)11;1-5-3-2-4-6(7)8-5/h(H,13,14)(H,15,16);2-4H,1H3,(H2,7,8) |
| InChIKey | VZCZCVAYGMXTHB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.06 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|