C20H24N4O6 — CID 139061555
(3aS,4R,7S,7aR)-2-(2-aminoethyl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 139061555) has the molecular formula C20H24N4O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is (3aS,4R,7S,7aR)-2-(2-aminoethyl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,4R,7S,7aR)-2-(2-aminoethyl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 139061555 |
| Molecular Formula | C20H24N4O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (3aS,4R,7S,7aR)-2-(2-aminoethyl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | NCCN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@@H]2O1.NCCN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/2C10H12N2O3/c2*11-3-4-12-9(13)7-5-1-2-6(15-5)8(7)10(12)14/h2*1-2,5-8H,3-4,11H2/t2*5-,6+,7-,8+ |
| InChIKey | YLOHWPDPSPFAIH-ATJSHDSKSA-N |
| XLogP | -2.23 |
| TPSA | 145.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|