About 6-amino-1H-pyrimidine-2,4-dione;1-methylpyrrolidin-2-one
6-amino-1H-pyrimidine-2,4-dione;1-methylpyrrolidin-2-one (PubChem CID 139061700) has the molecular formula C9H14N4O3
and a molecular weight of 226.24 g/mol. Its IUPAC name is 6-amino-1H-pyrimidine-2,4-dione;1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 6-amino-1H-pyrimidine-2,4-dione;1-methylpyrrolidin-2-one |
| PubChem CID | 139061700 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 6-amino-1H-pyrimidine-2,4-dione;1-methylpyrrolidin-2-one |
| SMILES | CN1CCCC1=O.Nc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C5H9NO.C4H5N3O2/c1-6-4-2-3-5(6)7;5-2-1-3(8)7-4(9)6-2/h2-4H2,1H3;1H,(H4,5,6,7,8,9) |
| InChIKey | VEJRCDOFRXZGEL-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-1H-pyrimidine-2,4-dione;1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1H-pyrimidine-2,4-dione;1-methylpyrrolidin-2-one?
The IUPAC name of 6-amino-1H-pyrimidine-2,4-dione;1-methylpyrrolidin-2-one (CID 139061700) is 6-amino-1H-pyrimidine-2,4-dione;1-methylpyrrolidin-2-one.
What is the SMILES notation for 6-amino-1H-pyrimidine-2,4-dione;1-methylpyrrolidin-2-one?
The canonical SMILES for 6-amino-1H-pyrimidine-2,4-dione;1-methylpyrrolidin-2-one is CN1CCCC1=O.Nc1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of 6-amino-1H-pyrimidine-2,4-dione;1-methylpyrrolidin-2-one?
The InChIKey is VEJRCDOFRXZGEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.C4H5N3O2/c1-6-4-2-3-5(6)7;5-2-1-3(8)7-4(9)6-2/h2-4H2,1H3;1H,(H4,5,6,7,8,9).
What are the key properties of 6-amino-1H-pyrimidine-2,4-dione;1-methylpyrrolidin-2-one?
6-amino-1H-pyrimidine-2,4-dione;1-methylpyrrolidin-2-one has a molecular weight of 226.24 g/mol, XLogP of -1.12, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1H-pyrimidine-2,4-dione;1-methylpyrrolidin-2-one is sourced from PubChem (CID 139061700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).