C22H20N2O9 — CID 139061737
4-methyl-2-(4-methylpyridin-1-ium-2-yl)pyridine;2,4,5-tricarboxybenzoate;hydrate (PubChem CID 139061737) has the molecular formula C22H20N2O9 and a molecular weight of 456.41 g/mol. Its IUPAC name is 4-methyl-2-(4-methylpyridin-1-ium-2-yl)pyridine;2,4,5-tricarboxybenzoate;hydrate.
| Compound Name | 4-methyl-2-(4-methylpyridin-1-ium-2-yl)pyridine;2,4,5-tricarboxybenzoate;hydrate |
|---|---|
| PubChem CID | 139061737 |
| Molecular Formula | C22H20N2O9 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 4-methyl-2-(4-methylpyridin-1-ium-2-yl)pyridine;2,4,5-tricarboxybenzoate;hydrate |
| SMILES | Cc1ccnc(-c2cc(C)cc[nH+]2)c1.O.O=C([O-])c1cc(C(=O)O)c(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C12H12N2.C10H6O8.H2O/c1-9-3-5-13-11(7-9)12-8-10(2)4-6-14-12;11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16;/h3-8H,1-2H3;1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18);1H2 |
| InChIKey | SNXKXLDXQYJQLD-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 210.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |