About 2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile;methylsulfinylmethane
2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile;methylsulfinylmethane (PubChem CID 139061923) has the molecular formula C9H12N2O3S
and a molecular weight of 228.27 g/mol. Its IUPAC name is 2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile;methylsulfinylmethane.
Molecular Properties
| Compound Name | 2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile;methylsulfinylmethane |
| PubChem CID | 139061923 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile;methylsulfinylmethane |
| SMILES | CS(C)=O.Cc1cc(=O)[nH]c(O)c1C#N |
| InChI | InChI=1S/C7H6N2O2.C2H6OS/c1-4-2-6(10)9-7(11)5(4)3-8;1-4(2)3/h2H,1H3,(H2,9,10,11);1-2H3 |
| InChIKey | SCXSBGPDXPDXKV-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile;methylsulfinylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile;methylsulfinylmethane?
The IUPAC name of 2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile;methylsulfinylmethane (CID 139061923) is 2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile;methylsulfinylmethane.
What is the SMILES notation for 2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile;methylsulfinylmethane?
The canonical SMILES for 2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile;methylsulfinylmethane is CS(C)=O.Cc1cc(=O)[nH]c(O)c1C#N.
What is the InChIKey of 2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile;methylsulfinylmethane?
The InChIKey is SCXSBGPDXPDXKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2.C2H6OS/c1-4-2-6(10)9-7(11)5(4)3-8;1-4(2)3/h2H,1H3,(H2,9,10,11);1-2H3.
What are the key properties of 2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile;methylsulfinylmethane?
2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile;methylsulfinylmethane has a molecular weight of 228.27 g/mol, XLogP of 0.26, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile;methylsulfinylmethane is sourced from PubChem (CID 139061923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).