About manganese(2+);bis((NE,3Z)-N-(1-pyrazin-2-ylethylidene)pyridine-3-carbohydrazonate)
manganese(2+);bis((NE,3Z)-N-(1-pyrazin-2-ylethylidene)pyridine-3-carbohydrazonate) (PubChem CID 139061947) has the molecular formula C24H20MnN10O2
and a molecular weight of 535.43 g/mol. Its IUPAC name is manganese(2+);bis((NE,3Z)-N-(1-pyrazin-2-ylethylidene)pyridine-3-carbohydrazonate).
Molecular Properties
| Compound Name | manganese(2+);bis((NE,3Z)-N-(1-pyrazin-2-ylethylidene)pyridine-3-carbohydrazonate) |
| PubChem CID | 139061947 |
| Molecular Formula | C24H20MnN10O2 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | manganese(2+);bis((NE,3Z)-N-(1-pyrazin-2-ylethylidene)pyridine-3-carbohydrazonate) |
| SMILES | C/C(=N\N=C(/[O-])c1cccnc1)c1cnccn1.C/C(=N\N=C(/[O-])c1cccnc1)c1cnccn1.[Mn+2] |
| InChI | InChI=1S/2C12H11N5O.Mn/c2*1-9(11-8-14-5-6-15-11)16-17-12(18)10-3-2-4-13-7-10;/h2*2-8H,1H3,(H,17,18);/q;;+2/p-2/b2*16-9+; |
| InChIKey | KIDKLBIRPMABEK-BSGNKXHSSA-L |
| XLogP | 0.80 |
| TPSA | 172.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze manganese(2+);bis((NE,3Z)-N-(1-pyrazin-2-ylethylidene)pyridine-3-carbohydrazonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(2+);bis((NE,3Z)-N-(1-pyrazin-2-ylethylidene)pyridine-3-carbohydrazonate)?
The IUPAC name of manganese(2+);bis((NE,3Z)-N-(1-pyrazin-2-ylethylidene)pyridine-3-carbohydrazonate) (CID 139061947) is manganese(2+);bis((NE,3Z)-N-(1-pyrazin-2-ylethylidene)pyridine-3-carbohydrazonate).
What is the SMILES notation for manganese(2+);bis((NE,3Z)-N-(1-pyrazin-2-ylethylidene)pyridine-3-carbohydrazonate)?
The canonical SMILES for manganese(2+);bis((NE,3Z)-N-(1-pyrazin-2-ylethylidene)pyridine-3-carbohydrazonate) is C/C(=N\N=C(/[O-])c1cccnc1)c1cnccn1.C/C(=N\N=C(/[O-])c1cccnc1)c1cnccn1.[Mn+2].
What is the InChIKey of manganese(2+);bis((NE,3Z)-N-(1-pyrazin-2-ylethylidene)pyridine-3-carbohydrazonate)?
The InChIKey is KIDKLBIRPMABEK-BSGNKXHSSA-L. The full InChI is InChI=1S/2C12H11N5O.Mn/c2*1-9(11-8-14-5-6-15-11)16-17-12(18)10-3-2-4-13-7-10;/h2*2-8H,1H3,(H,17,18);/q;;+2/p-2/b2*16-9+;.
What are the key properties of manganese(2+);bis((NE,3Z)-N-(1-pyrazin-2-ylethylidene)pyridine-3-carbohydrazonate)?
manganese(2+);bis((NE,3Z)-N-(1-pyrazin-2-ylethylidene)pyridine-3-carbohydrazonate) has a molecular weight of 535.43 g/mol, XLogP of 0.80, 6 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(2+);bis((NE,3Z)-N-(1-pyrazin-2-ylethylidene)pyridine-3-carbohydrazonate) is sourced from PubChem (CID 139061947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).