About but-2-ynedioate;4-pyridin-1-ium-4-ylpyridin-1-ium
but-2-ynedioate;4-pyridin-1-ium-4-ylpyridin-1-ium (PubChem CID 139062029) has the molecular formula C14H10N2O4
and a molecular weight of 270.24 g/mol. Its IUPAC name is but-2-ynedioate;4-pyridin-1-ium-4-ylpyridin-1-ium.
Molecular Properties
| Compound Name | but-2-ynedioate;4-pyridin-1-ium-4-ylpyridin-1-ium |
| PubChem CID | 139062029 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | but-2-ynedioate;4-pyridin-1-ium-4-ylpyridin-1-ium |
| SMILES | O=C([O-])C#CC(=O)[O-].c1cc(-c2cc[nH+]cc2)cc[nH+]1 |
| InChI | InChI=1S/C10H8N2.C4H2O4/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;5-3(6)1-2-4(7)8/h1-8H;(H,5,6)(H,7,8) |
| InChIKey | RRSVVSRTWHCHDS-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 108.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-2-ynedioate;4-pyridin-1-ium-4-ylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-ynedioate;4-pyridin-1-ium-4-ylpyridin-1-ium?
The IUPAC name of but-2-ynedioate;4-pyridin-1-ium-4-ylpyridin-1-ium (CID 139062029) is but-2-ynedioate;4-pyridin-1-ium-4-ylpyridin-1-ium.
What is the SMILES notation for but-2-ynedioate;4-pyridin-1-ium-4-ylpyridin-1-ium?
The canonical SMILES for but-2-ynedioate;4-pyridin-1-ium-4-ylpyridin-1-ium is O=C([O-])C#CC(=O)[O-].c1cc(-c2cc[nH+]cc2)cc[nH+]1.
What is the InChIKey of but-2-ynedioate;4-pyridin-1-ium-4-ylpyridin-1-ium?
The InChIKey is RRSVVSRTWHCHDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.C4H2O4/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;5-3(6)1-2-4(7)8/h1-8H;(H,5,6)(H,7,8).
What are the key properties of but-2-ynedioate;4-pyridin-1-ium-4-ylpyridin-1-ium?
but-2-ynedioate;4-pyridin-1-ium-4-ylpyridin-1-ium has a molecular weight of 270.24 g/mol, XLogP of -2.53, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-ynedioate;4-pyridin-1-ium-4-ylpyridin-1-ium is sourced from PubChem (CID 139062029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).