About 2-(4-methylphenyl)-4H-1,3-benzothiazine
2-(4-methylphenyl)-4H-1,3-benzothiazine (PubChem CID 139062050) has the molecular formula C15H13NS
and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-(4-methylphenyl)-4H-1,3-benzothiazine.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)-4H-1,3-benzothiazine |
| PubChem CID | 139062050 |
| Molecular Formula | C15H13NS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-(4-methylphenyl)-4H-1,3-benzothiazine |
| SMILES | Cc1ccc(C2=NCc3ccccc3S2)cc1 |
| InChI | InChI=1S/C15H13NS/c1-11-6-8-12(9-7-11)15-16-10-13-4-2-3-5-14(13)17-15/h2-9H,10H2,1H3 |
| InChIKey | XBZQKNAJEUMNOV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-methylphenyl)-4H-1,3-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)-4H-1,3-benzothiazine?
The IUPAC name of 2-(4-methylphenyl)-4H-1,3-benzothiazine (CID 139062050) is 2-(4-methylphenyl)-4H-1,3-benzothiazine.
What is the SMILES notation for 2-(4-methylphenyl)-4H-1,3-benzothiazine?
The canonical SMILES for 2-(4-methylphenyl)-4H-1,3-benzothiazine is Cc1ccc(C2=NCc3ccccc3S2)cc1.
What is the InChIKey of 2-(4-methylphenyl)-4H-1,3-benzothiazine?
The InChIKey is XBZQKNAJEUMNOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NS/c1-11-6-8-12(9-7-11)15-16-10-13-4-2-3-5-14(13)17-15/h2-9H,10H2,1H3.
What are the key properties of 2-(4-methylphenyl)-4H-1,3-benzothiazine?
2-(4-methylphenyl)-4H-1,3-benzothiazine has a molecular weight of 239.34 g/mol, XLogP of 4.05, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)-4H-1,3-benzothiazine is sourced from PubChem (CID 139062050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).