C24H42N2O2 — CID 139062130
N-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide (PubChem CID 139062130) has the molecular formula C24H42N2O2 and a molecular weight of 390.61 g/mol. Its IUPAC name is N-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide.
| Compound Name | N-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
|---|---|
| PubChem CID | 139062130 |
| Molecular Formula | C24H42N2O2 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.32 |
| IUPAC Name | N-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
| SMILES | CC(=O)N[C@@H]1C[C@H]2CC[C@]1(C)C2(C)C.CC(=O)N[C@@H]1C[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/2C12H21NO/c2*1-8(14)13-10-7-9-5-6-12(10,4)11(9,2)3/h2*9-10H,5-7H2,1-4H3,(H,13,14)/t2*9-,10-,12+/m11/s1 |
| InChIKey | XETODLOSGRCRLO-OHHVOCAESA-N |
| XLogP | 4.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |