About 4-amino-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide;1,4-dioxane
4-amino-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide;1,4-dioxane (PubChem CID 139062154) has the molecular formula C15H20N4O5S
and a molecular weight of 368.42 g/mol. Its IUPAC name is 4-amino-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide;1,4-dioxane.
Molecular Properties
| Compound Name | 4-amino-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide;1,4-dioxane |
| PubChem CID | 139062154 |
| Molecular Formula | C15H20N4O5S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 4-amino-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide;1,4-dioxane |
| SMILES | C1COCCO1.COc1cnc(NS(=O)(=O)c2ccc(N)cc2)nc1 |
| InChI | InChI=1S/C11H12N4O3S.C4H8O2/c1-18-9-6-13-11(14-7-9)15-19(16,17)10-4-2-8(12)3-5-10;1-2-6-4-3-5-1/h2-7H,12H2,1H3,(H,13,14,15);1-4H2 |
| InChIKey | FXOBGPFQTSMDDU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 125.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide;1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide;1,4-dioxane?
The IUPAC name of 4-amino-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide;1,4-dioxane (CID 139062154) is 4-amino-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide;1,4-dioxane.
What is the SMILES notation for 4-amino-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide;1,4-dioxane?
The canonical SMILES for 4-amino-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide;1,4-dioxane is C1COCCO1.COc1cnc(NS(=O)(=O)c2ccc(N)cc2)nc1.
What is the InChIKey of 4-amino-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide;1,4-dioxane?
The InChIKey is FXOBGPFQTSMDDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O3S.C4H8O2/c1-18-9-6-13-11(14-7-9)15-19(16,17)10-4-2-8(12)3-5-10;1-2-6-4-3-5-1/h2-7H,12H2,1H3,(H,13,14,15);1-4H2.
What are the key properties of 4-amino-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide;1,4-dioxane?
4-amino-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide;1,4-dioxane has a molecular weight of 368.42 g/mol, XLogP of 0.90, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide;1,4-dioxane is sourced from PubChem (CID 139062154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).