C15H20FNO — CID 139062278
(2R,4S)-7-fluoro-2-[(E)-pent-1-enyl]-2,3,4,5-tetrahydro-1H-1-benzazepin-4-ol (PubChem CID 139062278) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is (2R,4S)-7-fluoro-2-[(E)-pent-1-enyl]-2,3,4,5-tetrahydro-1H-1-benzazepin-4-ol.
| Compound Name | (2R,4S)-7-fluoro-2-[(E)-pent-1-enyl]-2,3,4,5-tetrahydro-1H-1-benzazepin-4-ol |
|---|---|
| PubChem CID | 139062278 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (2R,4S)-7-fluoro-2-[(E)-pent-1-enyl]-2,3,4,5-tetrahydro-1H-1-benzazepin-4-ol |
| SMILES | CCC/C=C/[C@H]1C[C@@H](O)Cc2cc(F)ccc2N1 |
| InChI | InChI=1S/C15H20FNO/c1-2-3-4-5-13-10-14(18)9-11-8-12(16)6-7-15(11)17-13/h4-8,13-14,17-18H,2-3,9-10H2,1H3/b5-4+/t13-,14-/m0/s1 |
| InChIKey | QOZVAVKZRDGUMU-CTXXGXLOSA-N |
| XLogP | 3.27 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|