About N,N-dimethylacetamide;pyrimidine-2,4-diamine
N,N-dimethylacetamide;pyrimidine-2,4-diamine (PubChem CID 139062338) has the molecular formula C8H15N5O
and a molecular weight of 197.24 g/mol. Its IUPAC name is N,N-dimethylacetamide;pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | N,N-dimethylacetamide;pyrimidine-2,4-diamine |
| PubChem CID | 139062338 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | N,N-dimethylacetamide;pyrimidine-2,4-diamine |
| SMILES | CC(=O)N(C)C.Nc1ccnc(N)n1 |
| InChI | InChI=1S/C4H6N4.C4H9NO/c5-3-1-2-7-4(6)8-3;1-4(6)5(2)3/h1-2H,(H4,5,6,7,8);1-3H3 |
| InChIKey | GPBVPBMNUKTVOU-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-dimethylacetamide;pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylacetamide;pyrimidine-2,4-diamine?
The IUPAC name of N,N-dimethylacetamide;pyrimidine-2,4-diamine (CID 139062338) is N,N-dimethylacetamide;pyrimidine-2,4-diamine.
What is the SMILES notation for N,N-dimethylacetamide;pyrimidine-2,4-diamine?
The canonical SMILES for N,N-dimethylacetamide;pyrimidine-2,4-diamine is CC(=O)N(C)C.Nc1ccnc(N)n1.
What is the InChIKey of N,N-dimethylacetamide;pyrimidine-2,4-diamine?
The InChIKey is GPBVPBMNUKTVOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4.C4H9NO/c5-3-1-2-7-4(6)8-3;1-4(6)5(2)3/h1-2H,(H4,5,6,7,8);1-3H3.
What are the key properties of N,N-dimethylacetamide;pyrimidine-2,4-diamine?
N,N-dimethylacetamide;pyrimidine-2,4-diamine has a molecular weight of 197.24 g/mol, XLogP of -0.26, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylacetamide;pyrimidine-2,4-diamine is sourced from PubChem (CID 139062338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).