About 2-methylpropylazanium;7-oxocyclohepta-1,3,5-trien-1-olate
2-methylpropylazanium;7-oxocyclohepta-1,3,5-trien-1-olate (PubChem CID 139062344) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-methylpropylazanium;7-oxocyclohepta-1,3,5-trien-1-olate.
Molecular Properties
| Compound Name | 2-methylpropylazanium;7-oxocyclohepta-1,3,5-trien-1-olate |
| PubChem CID | 139062344 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-methylpropylazanium;7-oxocyclohepta-1,3,5-trien-1-olate |
| SMILES | CC(C)C[NH3+].O=c1cccccc1[O-] |
| InChI | InChI=1S/C7H6O2.C4H11N/c8-6-4-2-1-3-5-7(6)9;1-4(2)3-5/h1-5H,(H,8,9);4H,3,5H2,1-2H3 |
| InChIKey | KSXOSFWGSNTAAM-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpropylazanium;7-oxocyclohepta-1,3,5-trien-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropylazanium;7-oxocyclohepta-1,3,5-trien-1-olate?
The IUPAC name of 2-methylpropylazanium;7-oxocyclohepta-1,3,5-trien-1-olate (CID 139062344) is 2-methylpropylazanium;7-oxocyclohepta-1,3,5-trien-1-olate.
What is the SMILES notation for 2-methylpropylazanium;7-oxocyclohepta-1,3,5-trien-1-olate?
The canonical SMILES for 2-methylpropylazanium;7-oxocyclohepta-1,3,5-trien-1-olate is CC(C)C[NH3+].O=c1cccccc1[O-].
What is the InChIKey of 2-methylpropylazanium;7-oxocyclohepta-1,3,5-trien-1-olate?
The InChIKey is KSXOSFWGSNTAAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C4H11N/c8-6-4-2-1-3-5-7(6)9;1-4(2)3-5/h1-5H,(H,8,9);4H,3,5H2,1-2H3.
What are the key properties of 2-methylpropylazanium;7-oxocyclohepta-1,3,5-trien-1-olate?
2-methylpropylazanium;7-oxocyclohepta-1,3,5-trien-1-olate has a molecular weight of 195.26 g/mol, XLogP of 0.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropylazanium;7-oxocyclohepta-1,3,5-trien-1-olate is sourced from PubChem (CID 139062344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).