C38H48N5Pd- — CID 139062432
methyl-[(2,3,7,8,12,13,17,18-octaethylporphyrin-5-yl)methyl]azanide;palladium (PubChem CID 139062432) has the molecular formula C38H48N5Pd- and a molecular weight of 681.26 g/mol. Its IUPAC name is methyl-[(2,3,7,8,12,13,17,18-octaethylporphyrin-5-yl)methyl]azanide;palladium.
| Compound Name | methyl-[(2,3,7,8,12,13,17,18-octaethylporphyrin-5-yl)methyl]azanide;palladium |
|---|---|
| PubChem CID | 139062432 |
| Molecular Formula | C38H48N5Pd- |
| Molecular Weight | 681.26 g/mol |
| Exact Mass | 680.30 |
| IUPAC Name | methyl-[(2,3,7,8,12,13,17,18-octaethylporphyrin-5-yl)methyl]azanide;palladium |
| SMILES | CCC1=C(CC)/C2=C/C3=N/C(=C\C4=N/C(=C(C[N-]C)\C5=N/C(=C\C1=N2)C(CC)=C5CC)C(CC)=C4CC)C(CC)=C3CC.[Pd] |
| InChI | InChI=1S/C38H48N5.Pd/c1-10-22-24(12-3)33-19-35-26(14-5)28(16-7)37(42-35)30(21-39-9)38-29(17-8)27(15-6)36(43-38)20-34-25(13-4)23(11-2)32(41-34)18-31(22)40-33;/h18-20H,10-17,21H2,1-9H3;/q-1;/b31-18-,32-18-,33-19-,34-20-,35-19-,36-20-,37-30-,38-30-; |
| InChIKey | NPMLOWPUBPLLGJ-XORVVQSUSA-N |
| XLogP | 10.19 |
| TPSA | 63.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.26 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |