About diphenylphosphinate;(4-methylphenyl)methylazanium
diphenylphosphinate;(4-methylphenyl)methylazanium (PubChem CID 139062444) has the molecular formula C20H22NO2P
and a molecular weight of 339.38 g/mol. Its IUPAC name is diphenylphosphinate;(4-methylphenyl)methylazanium.
Molecular Properties
| Compound Name | diphenylphosphinate;(4-methylphenyl)methylazanium |
| PubChem CID | 139062444 |
| Molecular Formula | C20H22NO2P |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | diphenylphosphinate;(4-methylphenyl)methylazanium |
| SMILES | Cc1ccc(C[NH3+])cc1.O=P([O-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H11O2P.C8H11N/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-7-2-4-8(6-9)5-3-7/h1-10H,(H,13,14);2-5H,6,9H2,1H3 |
| InChIKey | FVIUIMNAWONKFE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphinate;(4-methylphenyl)methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphinate;(4-methylphenyl)methylazanium?
The IUPAC name of diphenylphosphinate;(4-methylphenyl)methylazanium (CID 139062444) is diphenylphosphinate;(4-methylphenyl)methylazanium.
What is the SMILES notation for diphenylphosphinate;(4-methylphenyl)methylazanium?
The canonical SMILES for diphenylphosphinate;(4-methylphenyl)methylazanium is Cc1ccc(C[NH3+])cc1.O=P([O-])(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylphosphinate;(4-methylphenyl)methylazanium?
The InChIKey is FVIUIMNAWONKFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11O2P.C8H11N/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-7-2-4-8(6-9)5-3-7/h1-10H,(H,13,14);2-5H,6,9H2,1H3.
What are the key properties of diphenylphosphinate;(4-methylphenyl)methylazanium?
diphenylphosphinate;(4-methylphenyl)methylazanium has a molecular weight of 339.38 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphinate;(4-methylphenyl)methylazanium is sourced from PubChem (CID 139062444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).