About 3-bromothiophene-2-carboxylic acid;5-chloro-2,6-dimethylpyrimidin-4-amine
3-bromothiophene-2-carboxylic acid;5-chloro-2,6-dimethylpyrimidin-4-amine (PubChem CID 139062731) has the molecular formula C11H11BrClN3O2S
and a molecular weight of 364.65 g/mol. Its IUPAC name is 3-bromothiophene-2-carboxylic acid;5-chloro-2,6-dimethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 3-bromothiophene-2-carboxylic acid;5-chloro-2,6-dimethylpyrimidin-4-amine |
| PubChem CID | 139062731 |
| Molecular Formula | C11H11BrClN3O2S |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 362.94 |
| IUPAC Name | 3-bromothiophene-2-carboxylic acid;5-chloro-2,6-dimethylpyrimidin-4-amine |
| SMILES | Cc1nc(C)c(Cl)c(N)n1.O=C(O)c1sccc1Br |
| InChI | InChI=1S/C6H8ClN3.C5H3BrO2S/c1-3-5(7)6(8)10-4(2)9-3;6-3-1-2-9-4(3)5(7)8/h1-2H3,(H2,8,9,10);1-2H,(H,7,8) |
| InChIKey | QXSFFRPRRMOLBR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-bromothiophene-2-carboxylic acid;5-chloro-2,6-dimethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromothiophene-2-carboxylic acid;5-chloro-2,6-dimethylpyrimidin-4-amine?
The IUPAC name of 3-bromothiophene-2-carboxylic acid;5-chloro-2,6-dimethylpyrimidin-4-amine (CID 139062731) is 3-bromothiophene-2-carboxylic acid;5-chloro-2,6-dimethylpyrimidin-4-amine.
What is the SMILES notation for 3-bromothiophene-2-carboxylic acid;5-chloro-2,6-dimethylpyrimidin-4-amine?
The canonical SMILES for 3-bromothiophene-2-carboxylic acid;5-chloro-2,6-dimethylpyrimidin-4-amine is Cc1nc(C)c(Cl)c(N)n1.O=C(O)c1sccc1Br.
What is the InChIKey of 3-bromothiophene-2-carboxylic acid;5-chloro-2,6-dimethylpyrimidin-4-amine?
The InChIKey is QXSFFRPRRMOLBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClN3.C5H3BrO2S/c1-3-5(7)6(8)10-4(2)9-3;6-3-1-2-9-4(3)5(7)8/h1-2H3,(H2,8,9,10);1-2H,(H,7,8).
What are the key properties of 3-bromothiophene-2-carboxylic acid;5-chloro-2,6-dimethylpyrimidin-4-amine?
3-bromothiophene-2-carboxylic acid;5-chloro-2,6-dimethylpyrimidin-4-amine has a molecular weight of 364.65 g/mol, XLogP of 3.54, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromothiophene-2-carboxylic acid;5-chloro-2,6-dimethylpyrimidin-4-amine is sourced from PubChem (CID 139062731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).