C29H20Cl2F6N2O3S — CID 139062763
dichloromethane;4-[(3E,5E)-4-oxo-3,5-bis[[4-(trifluoromethyl)phenyl]methylidene]piperidin-1-yl]sulfonylbenzonitrile (PubChem CID 139062763) has the molecular formula C29H20Cl2F6N2O3S and a molecular weight of 661.45 g/mol. Its IUPAC name is dichloromethane;4-[(3E,5E)-4-oxo-3,5-bis[[4-(trifluoromethyl)phenyl]methylidene]piperidin-1-yl]sulfonylbenzonitrile.
| Compound Name | dichloromethane;4-[(3E,5E)-4-oxo-3,5-bis[[4-(trifluoromethyl)phenyl]methylidene]piperidin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 139062763 |
| Molecular Formula | C29H20Cl2F6N2O3S |
| Molecular Weight | 661.45 g/mol |
| Exact Mass | 660.05 |
| IUPAC Name | dichloromethane;4-[(3E,5E)-4-oxo-3,5-bis[[4-(trifluoromethyl)phenyl]methylidene]piperidin-1-yl]sulfonylbenzonitrile |
| SMILES | ClCCl.N#Cc1ccc(S(=O)(=O)N2C/C(=C\c3ccc(C(F)(F)F)cc3)C(=O)/C(=C/c3ccc(C(F)(F)F)cc3)C2)cc1 |
| InChI | InChI=1S/C28H18F6N2O3S.CH2Cl2/c29-27(30,31)23-7-1-18(2-8-23)13-21-16-36(40(38,39)25-11-5-20(15-35)6-12-25)17-22(26(21)37)14-19-3-9-24(10-4-19)28(32,33)34;2-1-3/h1-14H,16-17H2;1H2/b21-13+,22-14+; |
| InChIKey | MFFKLHAJXKVODH-JKBLJYNNSA-N |
| XLogP | 7.76 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.45 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|